About 2-(1,4,7,10-tetrazacyclododec-1-yl)cyclohexan-1-ol
2-(1,4,7,10-tetrazacyclododec-1-yl)cyclohexan-1-ol (PubChem CID 11011073) has the molecular formula C14H30N4O
and a molecular weight of 270.42 g/mol. Its IUPAC name is 2-(1,4,7,10-tetrazacyclododec-1-yl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-(1,4,7,10-tetrazacyclododec-1-yl)cyclohexan-1-ol |
| PubChem CID | 11011073 |
| Molecular Formula | C14H30N4O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | 2-(1,4,7,10-tetrazacyclododec-1-yl)cyclohexan-1-ol |
| SMILES | OC1CCCCC1N1CCNCCNCCNCC1 |
| InChI | InChI=1S/C14H30N4O/c19-14-4-2-1-3-13(14)18-11-9-16-7-5-15-6-8-17-10-12-18/h13-17,19H,1-12H2 |
| InChIKey | CKOAICAMEYFWNM-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,4,7,10-tetrazacyclododec-1-yl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4,7,10-tetrazacyclododec-1-yl)cyclohexan-1-ol?
The IUPAC name of 2-(1,4,7,10-tetrazacyclododec-1-yl)cyclohexan-1-ol (CID 11011073) is 2-(1,4,7,10-tetrazacyclododec-1-yl)cyclohexan-1-ol.
What is the SMILES notation for 2-(1,4,7,10-tetrazacyclododec-1-yl)cyclohexan-1-ol?
The canonical SMILES for 2-(1,4,7,10-tetrazacyclododec-1-yl)cyclohexan-1-ol is OC1CCCCC1N1CCNCCNCCNCC1.
What is the InChIKey of 2-(1,4,7,10-tetrazacyclododec-1-yl)cyclohexan-1-ol?
The InChIKey is CKOAICAMEYFWNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N4O/c19-14-4-2-1-3-13(14)18-11-9-16-7-5-15-6-8-17-10-12-18/h13-17,19H,1-12H2.
What are the key properties of 2-(1,4,7,10-tetrazacyclododec-1-yl)cyclohexan-1-ol?
2-(1,4,7,10-tetrazacyclododec-1-yl)cyclohexan-1-ol has a molecular weight of 270.42 g/mol, XLogP of -0.63, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4,7,10-tetrazacyclododec-1-yl)cyclohexan-1-ol is sourced from PubChem (CID 11011073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).