C14H28O3Si — CID 11011145
(3S,5Z,7R)-7-(2-trimethylsilylethoxymethoxy)octa-1,5-dien-3-ol (PubChem CID 11011145) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is (3S,5Z,7R)-7-(2-trimethylsilylethoxymethoxy)octa-1,5-dien-3-ol.
| Compound Name | (3S,5Z,7R)-7-(2-trimethylsilylethoxymethoxy)octa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 11011145 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (3S,5Z,7R)-7-(2-trimethylsilylethoxymethoxy)octa-1,5-dien-3-ol |
| SMILES | C=C[C@@H](O)C/C=C\[C@@H](C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C14H28O3Si/c1-6-14(15)9-7-8-13(2)17-12-16-10-11-18(3,4)5/h6-8,13-15H,1,9-12H2,2-5H3/b8-7-/t13-,14-/m1/s1 |
| InChIKey | KHFDCMQDOUOPIM-JUBSNLHESA-N |
| XLogP | 3.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|