About N-[[3-[1-(4-methyl-1,3-oxazole-5-carbonyl)piperidin-4-yl]pyrazin-2-yl]methyl]acetamide
N-[[3-[1-(4-methyl-1,3-oxazole-5-carbonyl)piperidin-4-yl]pyrazin-2-yl]methyl]acetamide (PubChem CID 110112298) has the molecular formula C17H21N5O3
and a molecular weight of 343.39 g/mol. Its IUPAC name is N-[[3-[1-(4-methyl-1,3-oxazole-5-carbonyl)piperidin-4-yl]pyrazin-2-yl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[3-[1-(4-methyl-1,3-oxazole-5-carbonyl)piperidin-4-yl]pyrazin-2-yl]methyl]acetamide |
| PubChem CID | 110112298 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-[[3-[1-(4-methyl-1,3-oxazole-5-carbonyl)piperidin-4-yl]pyrazin-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1nccnc1C1CCN(C(=O)c2ocnc2C)CC1 |
| InChI | InChI=1S/C17H21N5O3/c1-11-16(25-10-21-11)17(24)22-7-3-13(4-8-22)15-14(9-20-12(2)23)18-5-6-19-15/h5-6,10,13H,3-4,7-9H2,1-2H3,(H,20,23) |
| InChIKey | TVXGSQRFHALNRL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[3-[1-(4-methyl-1,3-oxazole-5-carbonyl)piperidin-4-yl]pyrazin-2-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-[1-(4-methyl-1,3-oxazole-5-carbonyl)piperidin-4-yl]pyrazin-2-yl]methyl]acetamide?
The IUPAC name of N-[[3-[1-(4-methyl-1,3-oxazole-5-carbonyl)piperidin-4-yl]pyrazin-2-yl]methyl]acetamide (CID 110112298) is N-[[3-[1-(4-methyl-1,3-oxazole-5-carbonyl)piperidin-4-yl]pyrazin-2-yl]methyl]acetamide.
What is the SMILES notation for N-[[3-[1-(4-methyl-1,3-oxazole-5-carbonyl)piperidin-4-yl]pyrazin-2-yl]methyl]acetamide?
The canonical SMILES for N-[[3-[1-(4-methyl-1,3-oxazole-5-carbonyl)piperidin-4-yl]pyrazin-2-yl]methyl]acetamide is CC(=O)NCc1nccnc1C1CCN(C(=O)c2ocnc2C)CC1.
What is the InChIKey of N-[[3-[1-(4-methyl-1,3-oxazole-5-carbonyl)piperidin-4-yl]pyrazin-2-yl]methyl]acetamide?
The InChIKey is TVXGSQRFHALNRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N5O3/c1-11-16(25-10-21-11)17(24)22-7-3-13(4-8-22)15-14(9-20-12(2)23)18-5-6-19-15/h5-6,10,13H,3-4,7-9H2,1-2H3,(H,20,23).
What are the key properties of N-[[3-[1-(4-methyl-1,3-oxazole-5-carbonyl)piperidin-4-yl]pyrazin-2-yl]methyl]acetamide?
N-[[3-[1-(4-methyl-1,3-oxazole-5-carbonyl)piperidin-4-yl]pyrazin-2-yl]methyl]acetamide has a molecular weight of 343.39 g/mol, XLogP of 1.43, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-[1-(4-methyl-1,3-oxazole-5-carbonyl)piperidin-4-yl]pyrazin-2-yl]methyl]acetamide is sourced from PubChem (CID 110112298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).