C15H18O5 — CID 11011315
methyl (1S,3R,6R,7R,10R)-3-methoxy-2-oxo-10-[(E)-prop-1-enyl]-4-oxatricyclo[4.3.1.03,7]dec-8-ene-8-carboxylate (PubChem CID 11011315) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is methyl (1S,3R,6R,7R,10R)-3-methoxy-2-oxo-10-[(E)-prop-1-enyl]-4-oxatricyclo[4.3.1.03,7]dec-8-ene-8-carboxylate.
| Compound Name | methyl (1S,3R,6R,7R,10R)-3-methoxy-2-oxo-10-[(E)-prop-1-enyl]-4-oxatricyclo[4.3.1.03,7]dec-8-ene-8-carboxylate |
|---|---|
| PubChem CID | 11011315 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | methyl (1S,3R,6R,7R,10R)-3-methoxy-2-oxo-10-[(E)-prop-1-enyl]-4-oxatricyclo[4.3.1.03,7]dec-8-ene-8-carboxylate |
| SMILES | C/C=C/[C@@H]1[C@H]2CO[C@@]3(OC)C(=O)[C@@H]1C=C(C(=O)OC)[C@@H]23 |
| InChI | InChI=1S/C15H18O5/c1-4-5-8-9-6-10(14(17)18-2)12-11(8)7-20-15(12,19-3)13(9)16/h4-6,8-9,11-12H,7H2,1-3H3/b5-4+/t8-,9+,11+,12-,15+/m0/s1 |
| InChIKey | IXFHXUWIARTGSL-ZHRBRYOMSA-N |
| XLogP | 1.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|