C16H24N6 — CID 110113217
N-methyl-3-[[1-[(2-methylpyrazol-3-yl)methyl]piperidin-3-yl]methyl]pyrazin-2-amine (PubChem CID 110113217) has the molecular formula C16H24N6 and a molecular weight of 300.41 g/mol. Its IUPAC name is N-methyl-3-[[1-[(2-methylpyrazol-3-yl)methyl]piperidin-3-yl]methyl]pyrazin-2-amine.
| Compound Name | N-methyl-3-[[1-[(2-methylpyrazol-3-yl)methyl]piperidin-3-yl]methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 110113217 |
| Molecular Formula | C16H24N6 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | N-methyl-3-[[1-[(2-methylpyrazol-3-yl)methyl]piperidin-3-yl]methyl]pyrazin-2-amine |
| SMILES | CNc1nccnc1CC1CCCN(Cc2ccnn2C)C1 |
| InChI | InChI=1S/C16H24N6/c1-17-16-15(18-7-8-19-16)10-13-4-3-9-22(11-13)12-14-5-6-20-21(14)2/h5-8,13H,3-4,9-12H2,1-2H3,(H,17,19) |
| InChIKey | JSQOXHLBZJMJND-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |