C15H25N5O2 — CID 110113853
2-(dimethylamino)-1-[3-[4-(dimethylamino)-6-methylpyrimidin-2-yl]morpholin-4-yl]ethanone (PubChem CID 110113853) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 2-(dimethylamino)-1-[3-[4-(dimethylamino)-6-methylpyrimidin-2-yl]morpholin-4-yl]ethanone.
| Compound Name | 2-(dimethylamino)-1-[3-[4-(dimethylamino)-6-methylpyrimidin-2-yl]morpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 110113853 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 2-(dimethylamino)-1-[3-[4-(dimethylamino)-6-methylpyrimidin-2-yl]morpholin-4-yl]ethanone |
| SMILES | Cc1cc(N(C)C)nc(C2COCCN2C(=O)CN(C)C)n1 |
| InChI | InChI=1S/C15H25N5O2/c1-11-8-13(19(4)5)17-15(16-11)12-10-22-7-6-20(12)14(21)9-18(2)3/h8,12H,6-7,9-10H2,1-5H3 |
| InChIKey | GCAJVRJPLFPESW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |