C16H24O4 — CID 11011393
methyl (1S,3aS,4S,6R)-7-formyl-4-hydroxy-1,3,3,6-tetramethyl-3a,4,5,6-tetrahydro-2H-indene-1-carboxylate (PubChem CID 11011393) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is methyl (1S,3aS,4S,6R)-7-formyl-4-hydroxy-1,3,3,6-tetramethyl-3a,4,5,6-tetrahydro-2H-indene-1-carboxylate.
| Compound Name | methyl (1S,3aS,4S,6R)-7-formyl-4-hydroxy-1,3,3,6-tetramethyl-3a,4,5,6-tetrahydro-2H-indene-1-carboxylate |
|---|---|
| PubChem CID | 11011393 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | methyl (1S,3aS,4S,6R)-7-formyl-4-hydroxy-1,3,3,6-tetramethyl-3a,4,5,6-tetrahydro-2H-indene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CC(C)(C)[C@H]2C1=C(C=O)[C@H](C)C[C@@H]2O |
| InChI | InChI=1S/C16H24O4/c1-9-6-11(18)13-12(10(9)7-17)16(4,14(19)20-5)8-15(13,2)3/h7,9,11,13,18H,6,8H2,1-5H3/t9-,11+,13-,16+/m1/s1 |
| InChIKey | CIWANMKRQBXGMX-NGMYAQNXSA-N |
| XLogP | 2.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|