C14H19NO5 — CID 11011424
[(2R,3S,4R)-4-acetyloxy-5-oxo-1,2-bis(prop-2-enyl)pyrrolidin-3-yl] acetate (PubChem CID 11011424) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is [(2R,3S,4R)-4-acetyloxy-5-oxo-1,2-bis(prop-2-enyl)pyrrolidin-3-yl] acetate.
| Compound Name | [(2R,3S,4R)-4-acetyloxy-5-oxo-1,2-bis(prop-2-enyl)pyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 11011424 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | [(2R,3S,4R)-4-acetyloxy-5-oxo-1,2-bis(prop-2-enyl)pyrrolidin-3-yl] acetate |
| SMILES | C=CC[C@@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)C(=O)N1CC=C |
| InChI | InChI=1S/C14H19NO5/c1-5-7-11-12(19-9(3)16)13(20-10(4)17)14(18)15(11)8-6-2/h5-6,11-13H,1-2,7-8H2,3-4H3/t11-,12+,13-/m1/s1 |
| InChIKey | RVHOHYXORAFGRG-FRRDWIJNSA-N |
| XLogP | 0.82 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|