About [4-methyl-4-(5-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone
[4-methyl-4-(5-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone (PubChem CID 110114467) has the molecular formula C15H18N2OS2
and a molecular weight of 306.46 g/mol. Its IUPAC name is [4-methyl-4-(5-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone.
Molecular Properties
| Compound Name | [4-methyl-4-(5-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone |
| PubChem CID | 110114467 |
| Molecular Formula | C15H18N2OS2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | [4-methyl-4-(5-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone |
| SMILES | Cc1cnc(C2(C)CCN(C(=O)c3ccsc3)CC2)s1 |
| InChI | InChI=1S/C15H18N2OS2/c1-11-9-16-14(20-11)15(2)4-6-17(7-5-15)13(18)12-3-8-19-10-12/h3,8-10H,4-7H2,1-2H3 |
| InChIKey | ZHQVAJDLUXQSEN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-methyl-4-(5-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methyl-4-(5-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone?
The IUPAC name of [4-methyl-4-(5-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone (CID 110114467) is [4-methyl-4-(5-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone.
What is the SMILES notation for [4-methyl-4-(5-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone?
The canonical SMILES for [4-methyl-4-(5-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone is Cc1cnc(C2(C)CCN(C(=O)c3ccsc3)CC2)s1.
What is the InChIKey of [4-methyl-4-(5-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone?
The InChIKey is ZHQVAJDLUXQSEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2OS2/c1-11-9-16-14(20-11)15(2)4-6-17(7-5-15)13(18)12-3-8-19-10-12/h3,8-10H,4-7H2,1-2H3.
What are the key properties of [4-methyl-4-(5-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone?
[4-methyl-4-(5-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone has a molecular weight of 306.46 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methyl-4-(5-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone is sourced from PubChem (CID 110114467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).