About [4-(5-chloro-1,3-thiazol-2-yl)-4-methylpiperidin-1-yl]-(5-ethyl-1,2-oxazol-3-yl)methanone
[4-(5-chloro-1,3-thiazol-2-yl)-4-methylpiperidin-1-yl]-(5-ethyl-1,2-oxazol-3-yl)methanone (PubChem CID 110114565) has the molecular formula C15H18ClN3O2S
and a molecular weight of 339.85 g/mol. Its IUPAC name is [4-(5-chloro-1,3-thiazol-2-yl)-4-methylpiperidin-1-yl]-(5-ethyl-1,2-oxazol-3-yl)methanone.
Molecular Properties
| Compound Name | [4-(5-chloro-1,3-thiazol-2-yl)-4-methylpiperidin-1-yl]-(5-ethyl-1,2-oxazol-3-yl)methanone |
| PubChem CID | 110114565 |
| Molecular Formula | C15H18ClN3O2S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | [4-(5-chloro-1,3-thiazol-2-yl)-4-methylpiperidin-1-yl]-(5-ethyl-1,2-oxazol-3-yl)methanone |
| SMILES | CCc1cc(C(=O)N2CCC(C)(c3ncc(Cl)s3)CC2)no1 |
| InChI | InChI=1S/C15H18ClN3O2S/c1-3-10-8-11(18-21-10)13(20)19-6-4-15(2,5-7-19)14-17-9-12(16)22-14/h8-9H,3-7H2,1-2H3 |
| InChIKey | MLUBEFAGRCDEFH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(5-chloro-1,3-thiazol-2-yl)-4-methylpiperidin-1-yl]-(5-ethyl-1,2-oxazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-chloro-1,3-thiazol-2-yl)-4-methylpiperidin-1-yl]-(5-ethyl-1,2-oxazol-3-yl)methanone?
The IUPAC name of [4-(5-chloro-1,3-thiazol-2-yl)-4-methylpiperidin-1-yl]-(5-ethyl-1,2-oxazol-3-yl)methanone (CID 110114565) is [4-(5-chloro-1,3-thiazol-2-yl)-4-methylpiperidin-1-yl]-(5-ethyl-1,2-oxazol-3-yl)methanone.
What is the SMILES notation for [4-(5-chloro-1,3-thiazol-2-yl)-4-methylpiperidin-1-yl]-(5-ethyl-1,2-oxazol-3-yl)methanone?
The canonical SMILES for [4-(5-chloro-1,3-thiazol-2-yl)-4-methylpiperidin-1-yl]-(5-ethyl-1,2-oxazol-3-yl)methanone is CCc1cc(C(=O)N2CCC(C)(c3ncc(Cl)s3)CC2)no1.
What is the InChIKey of [4-(5-chloro-1,3-thiazol-2-yl)-4-methylpiperidin-1-yl]-(5-ethyl-1,2-oxazol-3-yl)methanone?
The InChIKey is MLUBEFAGRCDEFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN3O2S/c1-3-10-8-11(18-21-10)13(20)19-6-4-15(2,5-7-19)14-17-9-12(16)22-14/h8-9H,3-7H2,1-2H3.
What are the key properties of [4-(5-chloro-1,3-thiazol-2-yl)-4-methylpiperidin-1-yl]-(5-ethyl-1,2-oxazol-3-yl)methanone?
[4-(5-chloro-1,3-thiazol-2-yl)-4-methylpiperidin-1-yl]-(5-ethyl-1,2-oxazol-3-yl)methanone has a molecular weight of 339.85 g/mol, XLogP of 3.54, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-chloro-1,3-thiazol-2-yl)-4-methylpiperidin-1-yl]-(5-ethyl-1,2-oxazol-3-yl)methanone is sourced from PubChem (CID 110114565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).