C18H18N6O2 — CID 110115882
[2-(2-methylpyrimidin-4-yl)morpholin-4-yl]-(6-pyrazol-1-yl-3-pyridinyl)methanone (PubChem CID 110115882) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is [2-(2-methylpyrimidin-4-yl)morpholin-4-yl]-(6-pyrazol-1-yl-3-pyridinyl)methanone.
| Compound Name | [2-(2-methylpyrimidin-4-yl)morpholin-4-yl]-(6-pyrazol-1-yl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 110115882 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | [2-(2-methylpyrimidin-4-yl)morpholin-4-yl]-(6-pyrazol-1-yl-3-pyridinyl)methanone |
| SMILES | Cc1nccc(C2CN(C(=O)c3ccc(-n4cccn4)nc3)CCO2)n1 |
| InChI | InChI=1S/C18H18N6O2/c1-13-19-7-5-15(22-13)16-12-23(9-10-26-16)18(25)14-3-4-17(20-11-14)24-8-2-6-21-24/h2-8,11,16H,9-10,12H2,1H3 |
| InChIKey | SXLQDAWQKXNNSC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 86.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |