C13H22O5Si — CID 11011601
(1R,2S,4S,5S,6R)-1-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,7-dioxatricyclo[4.2.1.02,4]nonan-8-one (PubChem CID 11011601) has the molecular formula C13H22O5Si and a molecular weight of 286.40 g/mol. Its IUPAC name is (1R,2S,4S,5S,6R)-1-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,7-dioxatricyclo[4.2.1.02,4]nonan-8-one.
| Compound Name | (1R,2S,4S,5S,6R)-1-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,7-dioxatricyclo[4.2.1.02,4]nonan-8-one |
|---|---|
| PubChem CID | 11011601 |
| Molecular Formula | C13H22O5Si |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (1R,2S,4S,5S,6R)-1-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,7-dioxatricyclo[4.2.1.02,4]nonan-8-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@]12C[C@@H](OC1=O)[C@H](O)[C@@H]1O[C@@H]12 |
| InChI | InChI=1S/C13H22O5Si/c1-12(2,3)19(4,5)18-13-6-7(16-11(13)15)8(14)9-10(13)17-9/h7-10,14H,6H2,1-5H3/t7-,8+,9+,10+,13-/m1/s1 |
| InChIKey | ZYKCCWDOQYDCAF-STDGDXHASA-N |
| XLogP | 1.20 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|