About 2-(3,8-dimethyl-6-pyridin-2-yl-2-bicyclo[5.1.0]octa-2,5-dienyl)pyridine
2-(3,8-dimethyl-6-pyridin-2-yl-2-bicyclo[5.1.0]octa-2,5-dienyl)pyridine (PubChem CID 11011669) has the molecular formula C20H20N2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-(3,8-dimethyl-6-pyridin-2-yl-2-bicyclo[5.1.0]octa-2,5-dienyl)pyridine.
Molecular Properties
| Compound Name | 2-(3,8-dimethyl-6-pyridin-2-yl-2-bicyclo[5.1.0]octa-2,5-dienyl)pyridine |
| PubChem CID | 11011669 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-(3,8-dimethyl-6-pyridin-2-yl-2-bicyclo[5.1.0]octa-2,5-dienyl)pyridine |
| SMILES | CC1=C(c2ccccn2)C2C(C)C2C(c2ccccn2)=CC1 |
| InChI | InChI=1S/C20H20N2/c1-13-9-10-15(16-7-3-5-11-21-16)19-14(2)20(19)18(13)17-8-4-6-12-22-17/h3-8,10-12,14,19-20H,9H2,1-2H3 |
| InChIKey | MEOHOYGFBDCVCY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,8-dimethyl-6-pyridin-2-yl-2-bicyclo[5.1.0]octa-2,5-dienyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,8-dimethyl-6-pyridin-2-yl-2-bicyclo[5.1.0]octa-2,5-dienyl)pyridine?
The IUPAC name of 2-(3,8-dimethyl-6-pyridin-2-yl-2-bicyclo[5.1.0]octa-2,5-dienyl)pyridine (CID 11011669) is 2-(3,8-dimethyl-6-pyridin-2-yl-2-bicyclo[5.1.0]octa-2,5-dienyl)pyridine.
What is the SMILES notation for 2-(3,8-dimethyl-6-pyridin-2-yl-2-bicyclo[5.1.0]octa-2,5-dienyl)pyridine?
The canonical SMILES for 2-(3,8-dimethyl-6-pyridin-2-yl-2-bicyclo[5.1.0]octa-2,5-dienyl)pyridine is CC1=C(c2ccccn2)C2C(C)C2C(c2ccccn2)=CC1.
What is the InChIKey of 2-(3,8-dimethyl-6-pyridin-2-yl-2-bicyclo[5.1.0]octa-2,5-dienyl)pyridine?
The InChIKey is MEOHOYGFBDCVCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2/c1-13-9-10-15(16-7-3-5-11-21-16)19-14(2)20(19)18(13)17-8-4-6-12-22-17/h3-8,10-12,14,19-20H,9H2,1-2H3.
What are the key properties of 2-(3,8-dimethyl-6-pyridin-2-yl-2-bicyclo[5.1.0]octa-2,5-dienyl)pyridine?
2-(3,8-dimethyl-6-pyridin-2-yl-2-bicyclo[5.1.0]octa-2,5-dienyl)pyridine has a molecular weight of 288.39 g/mol, XLogP of 4.62, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,8-dimethyl-6-pyridin-2-yl-2-bicyclo[5.1.0]octa-2,5-dienyl)pyridine is sourced from PubChem (CID 11011669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).