About N-[(2R,4S)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide
N-[(2R,4S)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide (PubChem CID 1101169) has the molecular formula C25H24N2O2
and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[(2R,4S)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide.
Molecular Properties
| Compound Name | N-[(2R,4S)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide |
| PubChem CID | 1101169 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N-[(2R,4S)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide |
| SMILES | CC(=O)N(c1ccccc1)[C@H]1C[C@@H](C)N(C(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H24N2O2/c1-18-17-24(27(19(2)28)21-13-7-4-8-14-21)22-15-9-10-16-23(22)26(18)25(29)20-11-5-3-6-12-20/h3-16,18,24H,17H2,1-2H3/t18-,24+/m1/s1 |
| InChIKey | JTPBHSOTKJMPKR-KOSHJBKYSA-N |
| XLogP | 5.22 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2R,4S)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R,4S)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide?
The IUPAC name of N-[(2R,4S)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide (CID 1101169) is N-[(2R,4S)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide.
What is the SMILES notation for N-[(2R,4S)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide?
The canonical SMILES for N-[(2R,4S)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide is CC(=O)N(c1ccccc1)[C@H]1C[C@@H](C)N(C(=O)c2ccccc2)c2ccccc21.
What is the InChIKey of N-[(2R,4S)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide?
The InChIKey is JTPBHSOTKJMPKR-KOSHJBKYSA-N. The full InChI is InChI=1S/C25H24N2O2/c1-18-17-24(27(19(2)28)21-13-7-4-8-14-21)22-15-9-10-16-23(22)26(18)25(29)20-11-5-3-6-12-20/h3-16,18,24H,17H2,1-2H3/t18-,24+/m1/s1.
What are the key properties of N-[(2R,4S)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide?
N-[(2R,4S)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide has a molecular weight of 384.48 g/mol, XLogP of 5.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R,4S)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide is sourced from PubChem (CID 1101169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).