C16H20N6O — CID 110117162
[2-[4-[(dimethylamino)methyl]pyrimidin-2-yl]pyrrolidin-1-yl]-pyrazin-2-ylmethanone (PubChem CID 110117162) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is [2-[4-[(dimethylamino)methyl]pyrimidin-2-yl]pyrrolidin-1-yl]-pyrazin-2-ylmethanone.
| Compound Name | [2-[4-[(dimethylamino)methyl]pyrimidin-2-yl]pyrrolidin-1-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 110117162 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | [2-[4-[(dimethylamino)methyl]pyrimidin-2-yl]pyrrolidin-1-yl]-pyrazin-2-ylmethanone |
| SMILES | CN(C)Cc1ccnc(C2CCCN2C(=O)c2cnccn2)n1 |
| InChI | InChI=1S/C16H20N6O/c1-21(2)11-12-5-6-19-15(20-12)14-4-3-9-22(14)16(23)13-10-17-7-8-18-13/h5-8,10,14H,3-4,9,11H2,1-2H3 |
| InChIKey | IFHAWFISRSYYIX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 75.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |