C17H25NO3 — CID 11011753
(2S,3aS,5S,7aS)-5-[(2S)-2-hydroxy-2-phenylethyl]-2,4-dimethyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridin-2-ol (PubChem CID 11011753) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (2S,3aS,5S,7aS)-5-[(2S)-2-hydroxy-2-phenylethyl]-2,4-dimethyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridin-2-ol.
| Compound Name | (2S,3aS,5S,7aS)-5-[(2S)-2-hydroxy-2-phenylethyl]-2,4-dimethyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridin-2-ol |
|---|---|
| PubChem CID | 11011753 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (2S,3aS,5S,7aS)-5-[(2S)-2-hydroxy-2-phenylethyl]-2,4-dimethyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridin-2-ol |
| SMILES | CN1[C@H](C[C@H](O)c2ccccc2)CC[C@@H]2O[C@](C)(O)C[C@@H]21 |
| InChI | InChI=1S/C17H25NO3/c1-17(20)11-14-16(21-17)9-8-13(18(14)2)10-15(19)12-6-4-3-5-7-12/h3-7,13-16,19-20H,8-11H2,1-2H3/t13-,14-,15-,16-,17-/m0/s1 |
| InChIKey | FDAXNEZUTYNBGI-WOYTXXSLSA-N |
| XLogP | 2.07 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |