C16H20FNO3 — CID 11011830
prop-2-enyl (3R,4S)-4-(4-fluorophenyl)-3-(hydroxymethyl)piperidine-1-carboxylate (PubChem CID 11011830) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is prop-2-enyl (3R,4S)-4-(4-fluorophenyl)-3-(hydroxymethyl)piperidine-1-carboxylate.
| Compound Name | prop-2-enyl (3R,4S)-4-(4-fluorophenyl)-3-(hydroxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11011830 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | prop-2-enyl (3R,4S)-4-(4-fluorophenyl)-3-(hydroxymethyl)piperidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC[C@H](c2ccc(F)cc2)[C@@H](CO)C1 |
| InChI | InChI=1S/C16H20FNO3/c1-2-9-21-16(20)18-8-7-15(13(10-18)11-19)12-3-5-14(17)6-4-12/h2-6,13,15,19H,1,7-11H2/t13-,15-/m1/s1 |
| InChIKey | ZCSPOTAUGLGORQ-UKRRQHHQSA-N |
| XLogP | 2.55 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|