About 1-[3-(1-methylpyrazolo[5,4-b]pyridin-6-yl)piperidin-1-yl]-2-thiophen-2-ylethanone
1-[3-(1-methylpyrazolo[5,4-b]pyridin-6-yl)piperidin-1-yl]-2-thiophen-2-ylethanone (PubChem CID 110118654) has the molecular formula C18H20N4OS
and a molecular weight of 340.45 g/mol. Its IUPAC name is 1-[3-(1-methylpyrazolo[5,4-b]pyridin-6-yl)piperidin-1-yl]-2-thiophen-2-ylethanone.
Molecular Properties
| Compound Name | 1-[3-(1-methylpyrazolo[5,4-b]pyridin-6-yl)piperidin-1-yl]-2-thiophen-2-ylethanone |
| PubChem CID | 110118654 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-[3-(1-methylpyrazolo[5,4-b]pyridin-6-yl)piperidin-1-yl]-2-thiophen-2-ylethanone |
| SMILES | Cn1ncc2ccc(C3CCCN(C(=O)Cc4cccs4)C3)nc21 |
| InChI | InChI=1S/C18H20N4OS/c1-21-18-13(11-19-21)6-7-16(20-18)14-4-2-8-22(12-14)17(23)10-15-5-3-9-24-15/h3,5-7,9,11,14H,2,4,8,10,12H2,1H3 |
| InChIKey | ULEFMLKJTYPZTI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-(1-methylpyrazolo[5,4-b]pyridin-6-yl)piperidin-1-yl]-2-thiophen-2-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(1-methylpyrazolo[5,4-b]pyridin-6-yl)piperidin-1-yl]-2-thiophen-2-ylethanone?
The IUPAC name of 1-[3-(1-methylpyrazolo[5,4-b]pyridin-6-yl)piperidin-1-yl]-2-thiophen-2-ylethanone (CID 110118654) is 1-[3-(1-methylpyrazolo[5,4-b]pyridin-6-yl)piperidin-1-yl]-2-thiophen-2-ylethanone.
What is the SMILES notation for 1-[3-(1-methylpyrazolo[5,4-b]pyridin-6-yl)piperidin-1-yl]-2-thiophen-2-ylethanone?
The canonical SMILES for 1-[3-(1-methylpyrazolo[5,4-b]pyridin-6-yl)piperidin-1-yl]-2-thiophen-2-ylethanone is Cn1ncc2ccc(C3CCCN(C(=O)Cc4cccs4)C3)nc21.
What is the InChIKey of 1-[3-(1-methylpyrazolo[5,4-b]pyridin-6-yl)piperidin-1-yl]-2-thiophen-2-ylethanone?
The InChIKey is ULEFMLKJTYPZTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4OS/c1-21-18-13(11-19-21)6-7-16(20-18)14-4-2-8-22(12-14)17(23)10-15-5-3-9-24-15/h3,5-7,9,11,14H,2,4,8,10,12H2,1H3.
What are the key properties of 1-[3-(1-methylpyrazolo[5,4-b]pyridin-6-yl)piperidin-1-yl]-2-thiophen-2-ylethanone?
1-[3-(1-methylpyrazolo[5,4-b]pyridin-6-yl)piperidin-1-yl]-2-thiophen-2-ylethanone has a molecular weight of 340.45 g/mol, XLogP of 2.98, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(1-methylpyrazolo[5,4-b]pyridin-6-yl)piperidin-1-yl]-2-thiophen-2-ylethanone is sourced from PubChem (CID 110118654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).