C20H41N — CID 11011888
(E)-N,N-dibutyl-5,5,7,7-tetramethyloct-2-en-1-amine (PubChem CID 11011888) has the molecular formula C20H41N and a molecular weight of 295.56 g/mol. Its IUPAC name is (E)-N,N-dibutyl-5,5,7,7-tetramethyloct-2-en-1-amine.
| Compound Name | (E)-N,N-dibutyl-5,5,7,7-tetramethyloct-2-en-1-amine |
|---|---|
| PubChem CID | 11011888 |
| Molecular Formula | C20H41N |
| Molecular Weight | 295.56 g/mol |
| Exact Mass | 295.32 |
| IUPAC Name | (E)-N,N-dibutyl-5,5,7,7-tetramethyloct-2-en-1-amine |
| SMILES | CCCCN(C/C=C/CC(C)(C)CC(C)(C)C)CCCC |
| InChI | InChI=1S/C20H41N/c1-8-10-15-21(16-11-9-2)17-13-12-14-20(6,7)18-19(3,4)5/h12-13H,8-11,14-18H2,1-7H3/b13-12+ |
| InChIKey | GHJNOUXFXKYHAD-OUKQBFOZSA-N |
| XLogP | 6.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|