C19H26OSi — CID 11011978
2-[(1S,2R)-2-[3-[dimethyl(phenyl)silyl]propa-1,2-dienyl]cyclohexyl]acetaldehyde (PubChem CID 11011978) has the molecular formula C19H26OSi and a molecular weight of 298.50 g/mol. Its IUPAC name is 2-[(1S,2R)-2-[3-[dimethyl(phenyl)silyl]propa-1,2-dienyl]cyclohexyl]acetaldehyde.
| Compound Name | 2-[(1S,2R)-2-[3-[dimethyl(phenyl)silyl]propa-1,2-dienyl]cyclohexyl]acetaldehyde |
|---|---|
| PubChem CID | 11011978 |
| Molecular Formula | C19H26OSi |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 2-[(1S,2R)-2-[3-[dimethyl(phenyl)silyl]propa-1,2-dienyl]cyclohexyl]acetaldehyde |
| SMILES | C[Si](C)(C=C=C[C@@H]1CCCC[C@H]1CC=O)c1ccccc1 |
| InChI | InChI=1S/C19H26OSi/c1-21(2,19-12-4-3-5-13-19)16-8-11-17-9-6-7-10-18(17)14-15-20/h3-5,11-13,15-18H,6-7,9-10,14H2,1-2H3/t8?,17-,18-/m0/s1 |
| InChIKey | ZJEJEJZFFDMPSO-LCJICXEISA-N |
| XLogP | 4.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|