C19H24OS — CID 11012041
(2S)-2-[(R)-phenyl(phenylsulfanyl)methyl]hexan-1-ol (PubChem CID 11012041) has the molecular formula C19H24OS and a molecular weight of 300.47 g/mol. Its IUPAC name is (2S)-2-[(R)-phenyl(phenylsulfanyl)methyl]hexan-1-ol.
| Compound Name | (2S)-2-[(R)-phenyl(phenylsulfanyl)methyl]hexan-1-ol |
|---|---|
| PubChem CID | 11012041 |
| Molecular Formula | C19H24OS |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (2S)-2-[(R)-phenyl(phenylsulfanyl)methyl]hexan-1-ol |
| SMILES | CCCC[C@@H](CO)[C@@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24OS/c1-2-3-10-17(15-20)19(16-11-6-4-7-12-16)21-18-13-8-5-9-14-18/h4-9,11-14,17,19-20H,2-3,10,15H2,1H3/t17-,19-/m0/s1 |
| InChIKey | OYQGBQONEODPSV-HKUYNNGSSA-N |
| XLogP | 5.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |