About 3-(iodomethyl)-4,5-dihydro-3H-2-benzoxepin-1-one
3-(iodomethyl)-4,5-dihydro-3H-2-benzoxepin-1-one (PubChem CID 11012087) has the molecular formula C11H11IO2
and a molecular weight of 302.11 g/mol. Its IUPAC name is 3-(iodomethyl)-4,5-dihydro-3H-2-benzoxepin-1-one.
Molecular Properties
| Compound Name | 3-(iodomethyl)-4,5-dihydro-3H-2-benzoxepin-1-one |
| PubChem CID | 11012087 |
| Molecular Formula | C11H11IO2 |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 3-(iodomethyl)-4,5-dihydro-3H-2-benzoxepin-1-one |
| SMILES | O=C1OC(CI)CCc2ccccc21 |
| InChI | InChI=1S/C11H11IO2/c12-7-9-6-5-8-3-1-2-4-10(8)11(13)14-9/h1-4,9H,5-7H2 |
| InChIKey | YBNWXYDQGJQYCG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(iodomethyl)-4,5-dihydro-3H-2-benzoxepin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(iodomethyl)-4,5-dihydro-3H-2-benzoxepin-1-one?
The IUPAC name of 3-(iodomethyl)-4,5-dihydro-3H-2-benzoxepin-1-one (CID 11012087) is 3-(iodomethyl)-4,5-dihydro-3H-2-benzoxepin-1-one.
What is the SMILES notation for 3-(iodomethyl)-4,5-dihydro-3H-2-benzoxepin-1-one?
The canonical SMILES for 3-(iodomethyl)-4,5-dihydro-3H-2-benzoxepin-1-one is O=C1OC(CI)CCc2ccccc21.
What is the InChIKey of 3-(iodomethyl)-4,5-dihydro-3H-2-benzoxepin-1-one?
The InChIKey is YBNWXYDQGJQYCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11IO2/c12-7-9-6-5-8-3-1-2-4-10(8)11(13)14-9/h1-4,9H,5-7H2.
What are the key properties of 3-(iodomethyl)-4,5-dihydro-3H-2-benzoxepin-1-one?
3-(iodomethyl)-4,5-dihydro-3H-2-benzoxepin-1-one has a molecular weight of 302.11 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(iodomethyl)-4,5-dihydro-3H-2-benzoxepin-1-one is sourced from PubChem (CID 11012087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).