C15H17N3O4 — CID 11012124
methyl (5R,8S)-7-benzyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-8-carboxylate (PubChem CID 11012124) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is methyl (5R,8S)-7-benzyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-8-carboxylate.
| Compound Name | methyl (5R,8S)-7-benzyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-8-carboxylate |
|---|---|
| PubChem CID | 11012124 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | methyl (5R,8S)-7-benzyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-8-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]2(CN1Cc1ccccc1)NC(=O)NC2=O |
| InChI | InChI=1S/C15H17N3O4/c1-22-12(19)11-7-15(13(20)16-14(21)17-15)9-18(11)8-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H2,16,17,20,21)/t11-,15+/m0/s1 |
| InChIKey | QQEBZNZMTMKRNN-XHDPSFHLSA-N |
| XLogP | 0.01 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|