C18H30O2Si — CID 11012234
(3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenylhexanal (PubChem CID 11012234) has the molecular formula C18H30O2Si and a molecular weight of 306.52 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenylhexanal.
| Compound Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenylhexanal |
|---|---|
| PubChem CID | 11012234 |
| Molecular Formula | C18H30O2Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenylhexanal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CC=O)CCCc1ccccc1 |
| InChI | InChI=1S/C18H30O2Si/c1-18(2,3)21(4,5)20-17(14-15-19)13-9-12-16-10-7-6-8-11-16/h6-8,10-11,15,17H,9,12-14H2,1-5H3/t17-/m1/s1 |
| InChIKey | IYUAHXKVIPELPI-QGZVFWFLSA-N |
| XLogP | 4.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|