C19H25ClFNO2 — CID 110122965
N-[(2R,4R,4aS,7R,8aR)-2-(2-chloro-4-fluorophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide (PubChem CID 110122965) has the molecular formula C19H25ClFNO2 and a molecular weight of 353.87 g/mol. Its IUPAC name is N-[(2R,4R,4aS,7R,8aR)-2-(2-chloro-4-fluorophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide.
| Compound Name | N-[(2R,4R,4aS,7R,8aR)-2-(2-chloro-4-fluorophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide |
|---|---|
| PubChem CID | 110122965 |
| Molecular Formula | C19H25ClFNO2 |
| Molecular Weight | 353.87 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N-[(2R,4R,4aS,7R,8aR)-2-(2-chloro-4-fluorophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide |
| SMILES | CC(=O)N[C@]1(C)C[C@H](c2ccc(F)cc2Cl)O[C@@H]2C[C@H](C)CC[C@H]21 |
| InChI | InChI=1S/C19H25ClFNO2/c1-11-4-7-15-17(8-11)24-18(10-19(15,3)22-12(2)23)14-6-5-13(21)9-16(14)20/h5-6,9,11,15,17-18H,4,7-8,10H2,1-3H3,(H,22,23)/t11-,15-,17-,18-,19-/m1/s1 |
| InChIKey | LNLAJJXLODLLSI-YBLNHRRYSA-N |
| XLogP | 4.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.87 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |