C21H29F2NO3 — CID 110122970
N-[(2R,4R,4aS,7R,8aR)-2-(2,5-difluorophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methoxypropanamide (PubChem CID 110122970) has the molecular formula C21H29F2NO3 and a molecular weight of 381.46 g/mol. Its IUPAC name is N-[(2R,4R,4aS,7R,8aR)-2-(2,5-difluorophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methoxypropanamide.
| Compound Name | N-[(2R,4R,4aS,7R,8aR)-2-(2,5-difluorophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 110122970 |
| Molecular Formula | C21H29F2NO3 |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-[(2R,4R,4aS,7R,8aR)-2-(2,5-difluorophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methoxypropanamide |
| SMILES | COCCC(=O)N[C@]1(C)C[C@H](c2cc(F)ccc2F)O[C@@H]2C[C@H](C)CC[C@H]21 |
| InChI | InChI=1S/C21H29F2NO3/c1-13-4-6-16-18(10-13)27-19(15-11-14(22)5-7-17(15)23)12-21(16,2)24-20(25)8-9-26-3/h5,7,11,13,16,18-19H,4,6,8-10,12H2,1-3H3,(H,24,25)/t13-,16-,18-,19-,21-/m1/s1 |
| InChIKey | UJKNQCMJBZVGAY-UFXVLNHOSA-N |
| XLogP | 4.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |