C23H33FN2O3 — CID 110122986
N-[(2R,4R,4aS,7R,8aR)-2-(3-fluoro-4-morpholin-4-ylphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide (PubChem CID 110122986) has the molecular formula C23H33FN2O3 and a molecular weight of 404.50 g/mol. Its IUPAC name is N-[(2R,4R,4aS,7R,8aR)-2-(3-fluoro-4-morpholin-4-ylphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide.
| Compound Name | N-[(2R,4R,4aS,7R,8aR)-2-(3-fluoro-4-morpholin-4-ylphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide |
|---|---|
| PubChem CID | 110122986 |
| Molecular Formula | C23H33FN2O3 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | N-[(2R,4R,4aS,7R,8aR)-2-(3-fluoro-4-morpholin-4-ylphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H](C[C@@]2(C)NC(=O)C)C3=CC(=C(C=C3)N4CCOCC4)F |
| InChI | InChI=1S/C23H33FN2O3/c1-15-4-6-18-21(12-15)29-22(14-23(18,3)25-16(2)27)17-5-7-20(19(24)13-17)26-8-10-28-11-9-26/h5,7,13,15,18,21-22H,4,6,8-12,14H2,1-3H3,(H,25,27)/t15-,18-,21-,22-,23-/m1/s1 |
| InChIKey | MGFIWVLLNCXENP-SPWZGRHWSA-N |
| XLogP | 3.30 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | 584 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |