C25H37FN2O4 — CID 110122987
N-[(2R,4R,4aS,7R,8aR)-2-(3-fluoro-4-morpholin-4-ylphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methoxypropanamide (PubChem CID 110122987) has the molecular formula C25H37FN2O4 and a molecular weight of 448.58 g/mol. Its IUPAC name is N-[(2R,4R,4aS,7R,8aR)-2-(3-fluoro-4-morpholin-4-ylphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methoxypropanamide.
| Compound Name | N-[(2R,4R,4aS,7R,8aR)-2-(3-fluoro-4-morpholin-4-ylphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 110122987 |
| Molecular Formula | C25H37FN2O4 |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | N-[(2R,4R,4aS,7R,8aR)-2-(3-fluoro-4-morpholin-4-ylphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methoxypropanamide |
| SMILES | COCCC(=O)N[C@]1(C)C[C@H](c2ccc(N3CCOCC3)c(F)c2)O[C@@H]2C[C@H](C)CC[C@H]21 |
| InChI | InChI=1S/C25H37FN2O4/c1-17-4-6-19-22(14-17)32-23(16-25(19,2)27-24(29)8-11-30-3)18-5-7-21(20(26)15-18)28-9-12-31-13-10-28/h5,7,15,17,19,22-23H,4,6,8-14,16H2,1-3H3,(H,27,29)/t17-,19-,22-,23-,25-/m1/s1 |
| InChIKey | XRESFXBIRBRRSA-RPMDWDEOSA-N |
| XLogP | 3.84 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |