C21H28F3NO3 — CID 110122994
N-[(2R,4R,4aS,7R,8aR)-4,7-dimethyl-2-(2,4,5-trifluorophenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methoxypropanamide (PubChem CID 110122994) has the molecular formula C21H28F3NO3 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-[(2R,4R,4aS,7R,8aR)-4,7-dimethyl-2-(2,4,5-trifluorophenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methoxypropanamide.
| Compound Name | N-[(2R,4R,4aS,7R,8aR)-4,7-dimethyl-2-(2,4,5-trifluorophenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 110122994 |
| Molecular Formula | C21H28F3NO3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-[(2R,4R,4aS,7R,8aR)-4,7-dimethyl-2-(2,4,5-trifluorophenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methoxypropanamide |
| SMILES | COCCC(=O)N[C@]1(C)C[C@H](c2cc(F)c(F)cc2F)O[C@@H]2C[C@H](C)CC[C@H]21 |
| InChI | InChI=1S/C21H28F3NO3/c1-12-4-5-14-18(8-12)28-19(13-9-16(23)17(24)10-15(13)22)11-21(14,2)25-20(26)6-7-27-3/h9-10,12,14,18-19H,4-8,11H2,1-3H3,(H,25,26)/t12-,14-,18-,19-,21-/m1/s1 |
| InChIKey | BIBPGWMKBICRAV-QRWGEDBWSA-N |
| XLogP | 4.28 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|