About 4-[(1,3-dioxo-2-benzofuran-4-yl)oxy]-2-benzofuran-1,3-dione
4-[(1,3-dioxo-2-benzofuran-4-yl)oxy]-2-benzofuran-1,3-dione (PubChem CID 11012332) has the molecular formula C16H6O7
and a molecular weight of 310.22 g/mol. Its IUPAC name is 4-[(1,3-dioxo-2-benzofuran-4-yl)oxy]-2-benzofuran-1,3-dione.
Molecular Properties
| Compound Name | 4-[(1,3-dioxo-2-benzofuran-4-yl)oxy]-2-benzofuran-1,3-dione |
| PubChem CID | 11012332 |
| Molecular Formula | C16H6O7 |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 4-[(1,3-dioxo-2-benzofuran-4-yl)oxy]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2c(Oc3cccc4c3C(=O)OC4=O)cccc21 |
| InChI | InChI=1S/C16H6O7/c17-13-7-3-1-5-9(11(7)15(19)22-13)21-10-6-2-4-8-12(10)16(20)23-14(8)18/h1-6H |
| InChIKey | BCJIMAHNJOIWKQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1,3-dioxo-2-benzofuran-4-yl)oxy]-2-benzofuran-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1,3-dioxo-2-benzofuran-4-yl)oxy]-2-benzofuran-1,3-dione?
The IUPAC name of 4-[(1,3-dioxo-2-benzofuran-4-yl)oxy]-2-benzofuran-1,3-dione (CID 11012332) is 4-[(1,3-dioxo-2-benzofuran-4-yl)oxy]-2-benzofuran-1,3-dione.
What is the SMILES notation for 4-[(1,3-dioxo-2-benzofuran-4-yl)oxy]-2-benzofuran-1,3-dione?
The canonical SMILES for 4-[(1,3-dioxo-2-benzofuran-4-yl)oxy]-2-benzofuran-1,3-dione is O=C1OC(=O)c2c(Oc3cccc4c3C(=O)OC4=O)cccc21.
What is the InChIKey of 4-[(1,3-dioxo-2-benzofuran-4-yl)oxy]-2-benzofuran-1,3-dione?
The InChIKey is BCJIMAHNJOIWKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H6O7/c17-13-7-3-1-5-9(11(7)15(19)22-13)21-10-6-2-4-8-12(10)16(20)23-14(8)18/h1-6H.
What are the key properties of 4-[(1,3-dioxo-2-benzofuran-4-yl)oxy]-2-benzofuran-1,3-dione?
4-[(1,3-dioxo-2-benzofuran-4-yl)oxy]-2-benzofuran-1,3-dione has a molecular weight of 310.22 g/mol, XLogP of 2.10, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,3-dioxo-2-benzofuran-4-yl)oxy]-2-benzofuran-1,3-dione is sourced from PubChem (CID 11012332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).