C19H32N4O2 — CID 110124779
(5aS,9aR)-1-(2-methoxyethyl)-7-[(1,3,5-trimethylpyrazol-4-yl)methyl]-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one (PubChem CID 110124779) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is (5aS,9aR)-1-(2-methoxyethyl)-7-[(1,3,5-trimethylpyrazol-4-yl)methyl]-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one.
| Compound Name | (5aS,9aR)-1-(2-methoxyethyl)-7-[(1,3,5-trimethylpyrazol-4-yl)methyl]-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one |
|---|---|
| PubChem CID | 110124779 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (5aS,9aR)-1-(2-methoxyethyl)-7-[(1,3,5-trimethylpyrazol-4-yl)methyl]-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one |
| SMILES | COCCN1C(=O)CCC[C@H]2CN(Cc3c(C)nn(C)c3C)CC[C@H]21 |
| InChI | InChI=1S/C19H32N4O2/c1-14-17(15(2)21(3)20-14)13-22-9-8-18-16(12-22)6-5-7-19(24)23(18)10-11-25-4/h16,18H,5-13H2,1-4H3/t16-,18+/m0/s1 |
| InChIKey | XZJCBDFKKTWSIP-FUHWJXTLSA-N |
| XLogP | 1.89 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |