C18H23FN2O3 — CID 110124832
(4aR,9aR)-1-(5-fluoro-2-methoxybenzoyl)-5-methyl-2,3,4,4a,7,8,9,9a-octahydropyrido[3,2-b]azepin-6-one (PubChem CID 110124832) has the molecular formula C18H23FN2O3 and a molecular weight of 334.39 g/mol. Its IUPAC name is (4aR,9aR)-1-(5-fluoro-2-methoxybenzoyl)-5-methyl-2,3,4,4a,7,8,9,9a-octahydropyrido[3,2-b]azepin-6-one.
| Compound Name | (4aR,9aR)-1-(5-fluoro-2-methoxybenzoyl)-5-methyl-2,3,4,4a,7,8,9,9a-octahydropyrido[3,2-b]azepin-6-one |
|---|---|
| PubChem CID | 110124832 |
| Molecular Formula | C18H23FN2O3 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (4aR,9aR)-1-(5-fluoro-2-methoxybenzoyl)-5-methyl-2,3,4,4a,7,8,9,9a-octahydropyrido[3,2-b]azepin-6-one |
| SMILES | COc1ccc(F)cc1C(=O)N1CCC[C@@H]2[C@H]1CCCC(=O)N2C |
| InChI | InChI=1S/C18H23FN2O3/c1-20-14-6-4-10-21(15(14)5-3-7-17(20)22)18(23)13-11-12(19)8-9-16(13)24-2/h8-9,11,14-15H,3-7,10H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | XRKAICMXOIHIQW-HUUCEWRRSA-N |
| XLogP | 2.45 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |