About 2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]-N-methylacetamide
2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]-N-methylacetamide (PubChem CID 110125284) has the molecular formula C11H21NO4
and a molecular weight of 231.29 g/mol. Its IUPAC name is 2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]-N-methylacetamide.
Molecular Properties
| Compound Name | 2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]-N-methylacetamide |
| PubChem CID | 110125284 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]-N-methylacetamide |
| SMILES | CCOCC(=O)N(C)[C@@H]1CC[C@@H](OC)[C@@H]1O |
| InChI | InChI=1S/C11H21NO4/c1-4-16-7-10(13)12(2)8-5-6-9(15-3)11(8)14/h8-9,11,14H,4-7H2,1-3H3/t8-,9-,11-/m1/s1 |
| InChIKey | PROFFSKUPAOSLO-FXPVBKGRSA-N |
| XLogP | 0.02 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]-N-methylacetamide?
The IUPAC name of 2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]-N-methylacetamide (CID 110125284) is 2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]-N-methylacetamide.
What is the SMILES notation for 2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]-N-methylacetamide?
The canonical SMILES for 2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]-N-methylacetamide is CCOCC(=O)N(C)[C@@H]1CC[C@@H](OC)[C@@H]1O.
What is the InChIKey of 2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]-N-methylacetamide?
The InChIKey is PROFFSKUPAOSLO-FXPVBKGRSA-N. The full InChI is InChI=1S/C11H21NO4/c1-4-16-7-10(13)12(2)8-5-6-9(15-3)11(8)14/h8-9,11,14H,4-7H2,1-3H3/t8-,9-,11-/m1/s1.
What are the key properties of 2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]-N-methylacetamide?
2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]-N-methylacetamide has a molecular weight of 231.29 g/mol, XLogP of 0.02, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]-N-methylacetamide is sourced from PubChem (CID 110125284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).