C14H25NO3 — CID 110125825
2-cyclopentyl-N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]acetamide (PubChem CID 110125825) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-cyclopentyl-N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]acetamide |
|---|---|
| PubChem CID | 110125825 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 2-cyclopentyl-N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]acetamide |
| SMILES | O=C(CC1CCCC1)N[C@@H]1CCCC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H25NO3/c16-12-8-4-3-7-11(14(12)18)15-13(17)9-10-5-1-2-6-10/h10-12,14,16,18H,1-9H2,(H,15,17)/t11-,12-,14-/m1/s1 |
| InChIKey | AXCVHUDLPBCCGN-YRGRVCCFSA-N |
| XLogP | 1.35 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |