About 1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine
1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine (PubChem CID 11012620) has the molecular formula C21H25N3
and a molecular weight of 319.45 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine.
Molecular Properties
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine |
| PubChem CID | 11012620 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine |
| SMILES | [H]N=c1n(-c2c(C)cc(C)cc2C)ccn1-c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C21H25N3/c1-13-9-15(3)19(16(4)10-13)23-7-8-24(21(23)22)20-17(5)11-14(2)12-18(20)6/h7-12,22H,1-6H3 |
| InChIKey | GPQZVAOQFZERRV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 33.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine?
The IUPAC name of 1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine (CID 11012620) is 1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine.
What is the SMILES notation for 1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine?
The canonical SMILES for 1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine is [H]N=c1n(-c2c(C)cc(C)cc2C)ccn1-c1c(C)cc(C)cc1C.
What is the InChIKey of 1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine?
The InChIKey is GPQZVAOQFZERRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3/c1-13-9-15(3)19(16(4)10-13)23-7-8-24(21(23)22)20-17(5)11-14(2)12-18(20)6/h7-12,22H,1-6H3.
What are the key properties of 1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine?
1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine has a molecular weight of 319.45 g/mol, XLogP of 4.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(2,4,6-trimethylphenyl)imidazol-2-imine is sourced from PubChem (CID 11012620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).