C15H23N3O2S — CID 110126343
[(3aS,5R,7aR)-5-methoxy-3a-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(4-ethylthiadiazol-5-yl)methanone (PubChem CID 110126343) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is [(3aS,5R,7aR)-5-methoxy-3a-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(4-ethylthiadiazol-5-yl)methanone.
| Compound Name | [(3aS,5R,7aR)-5-methoxy-3a-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(4-ethylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 110126343 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | [(3aS,5R,7aR)-5-methoxy-3a-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(4-ethylthiadiazol-5-yl)methanone |
| SMILES | CCc1nnsc1C(=O)N1CC[C@@]2(C)C[C@H](OC)CC[C@@H]12 |
| InChI | InChI=1S/C15H23N3O2S/c1-4-11-13(21-17-16-11)14(19)18-8-7-15(2)9-10(20-3)5-6-12(15)18/h10,12H,4-9H2,1-3H3/t10-,12-,15+/m1/s1 |
| InChIKey | IIKWVQARIADVCQ-HCKVZZMMSA-N |
| XLogP | 2.52 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |