C21H27N3O2 — CID 110126609
1-[(3aS,6aR)-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-4-pyrazol-1-ylbutan-1-one (PubChem CID 110126609) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-[(3aS,6aR)-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-4-pyrazol-1-ylbutan-1-one.
| Compound Name | 1-[(3aS,6aR)-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-4-pyrazol-1-ylbutan-1-one |
|---|---|
| PubChem CID | 110126609 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-[(3aS,6aR)-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-4-pyrazol-1-ylbutan-1-one |
| SMILES | O=C(CCCn1cccn1)N1C[C@H]2CC(OCc3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C21H27N3O2/c25-21(8-4-10-24-11-5-9-22-24)23-14-18-12-20(13-19(18)15-23)26-16-17-6-2-1-3-7-17/h1-3,5-7,9,11,18-20H,4,8,10,12-16H2/t18-,19+,20? |
| InChIKey | PATCPKWKCLGCFI-YOFSQIOKSA-N |
| XLogP | 3.12 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |