About N-[(4S,5S)-5-hydroxy-1-methylsulfonylazepan-4-yl]-2-methylpropanamide
N-[(4S,5S)-5-hydroxy-1-methylsulfonylazepan-4-yl]-2-methylpropanamide (PubChem CID 110126661) has the molecular formula C11H22N2O4S
and a molecular weight of 278.37 g/mol. Its IUPAC name is N-[(4S,5S)-5-hydroxy-1-methylsulfonylazepan-4-yl]-2-methylpropanamide.
Molecular Properties
| Compound Name | N-[(4S,5S)-5-hydroxy-1-methylsulfonylazepan-4-yl]-2-methylpropanamide |
| PubChem CID | 110126661 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-[(4S,5S)-5-hydroxy-1-methylsulfonylazepan-4-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)N[C@H]1CCN(S(C)(=O)=O)CC[C@@H]1O |
| InChI | InChI=1S/C11H22N2O4S/c1-8(2)11(15)12-9-4-6-13(18(3,16)17)7-5-10(9)14/h8-10,14H,4-7H2,1-3H3,(H,12,15)/t9-,10-/m0/s1 |
| InChIKey | UUUVACHDTAOZFF-UWVGGRQHSA-N |
| XLogP | -0.46 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(4S,5S)-5-hydroxy-1-methylsulfonylazepan-4-yl]-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4S,5S)-5-hydroxy-1-methylsulfonylazepan-4-yl]-2-methylpropanamide?
The IUPAC name of N-[(4S,5S)-5-hydroxy-1-methylsulfonylazepan-4-yl]-2-methylpropanamide (CID 110126661) is N-[(4S,5S)-5-hydroxy-1-methylsulfonylazepan-4-yl]-2-methylpropanamide.
What is the SMILES notation for N-[(4S,5S)-5-hydroxy-1-methylsulfonylazepan-4-yl]-2-methylpropanamide?
The canonical SMILES for N-[(4S,5S)-5-hydroxy-1-methylsulfonylazepan-4-yl]-2-methylpropanamide is CC(C)C(=O)N[C@H]1CCN(S(C)(=O)=O)CC[C@@H]1O.
What is the InChIKey of N-[(4S,5S)-5-hydroxy-1-methylsulfonylazepan-4-yl]-2-methylpropanamide?
The InChIKey is UUUVACHDTAOZFF-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H22N2O4S/c1-8(2)11(15)12-9-4-6-13(18(3,16)17)7-5-10(9)14/h8-10,14H,4-7H2,1-3H3,(H,12,15)/t9-,10-/m0/s1.
What are the key properties of N-[(4S,5S)-5-hydroxy-1-methylsulfonylazepan-4-yl]-2-methylpropanamide?
N-[(4S,5S)-5-hydroxy-1-methylsulfonylazepan-4-yl]-2-methylpropanamide has a molecular weight of 278.37 g/mol, XLogP of -0.46, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4S,5S)-5-hydroxy-1-methylsulfonylazepan-4-yl]-2-methylpropanamide is sourced from PubChem (CID 110126661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).