C21H28N2O3 — CID 110126991
(4aS,9aS)-4-(2-methylpropyl)-7-[(E)-3-phenylprop-2-enoyl]-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one (PubChem CID 110126991) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is (4aS,9aS)-4-(2-methylpropyl)-7-[(E)-3-phenylprop-2-enoyl]-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one.
| Compound Name | (4aS,9aS)-4-(2-methylpropyl)-7-[(E)-3-phenylprop-2-enoyl]-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one |
|---|---|
| PubChem CID | 110126991 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (4aS,9aS)-4-(2-methylpropyl)-7-[(E)-3-phenylprop-2-enoyl]-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one |
| SMILES | CC(C)CN1C(=O)CO[C@H]2CCN(C(=O)/C=C/c3ccccc3)CC[C@@H]21 |
| InChI | InChI=1S/C21H28N2O3/c1-16(2)14-23-18-10-12-22(13-11-19(18)26-15-21(23)25)20(24)9-8-17-6-4-3-5-7-17/h3-9,16,18-19H,10-15H2,1-2H3/b9-8+/t18-,19-/m0/s1 |
| InChIKey | RKGNUNPLVCTNDE-VANUVFSVSA-N |
| XLogP | 2.57 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|