C18H24N2O4 — CID 110127073
(4aS,9aS)-7-(2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carbonyl)-4a,5,6,8,9,9a-hexahydro-4H-[1,4]oxazino[2,3-d]azepin-3-one (PubChem CID 110127073) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is (4aS,9aS)-7-(2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carbonyl)-4a,5,6,8,9,9a-hexahydro-4H-[1,4]oxazino[2,3-d]azepin-3-one.
| Compound Name | (4aS,9aS)-7-(2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carbonyl)-4a,5,6,8,9,9a-hexahydro-4H-[1,4]oxazino[2,3-d]azepin-3-one |
|---|---|
| PubChem CID | 110127073 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (4aS,9aS)-7-(2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carbonyl)-4a,5,6,8,9,9a-hexahydro-4H-[1,4]oxazino[2,3-d]azepin-3-one |
| SMILES | Cc1oc2c(c1C(=O)N1CC[C@@H]3NC(=O)CO[C@H]3CC1)CCCC2 |
| InChI | InChI=1S/C18H24N2O4/c1-11-17(12-4-2-3-5-14(12)24-11)18(22)20-8-6-13-15(7-9-20)23-10-16(21)19-13/h13,15H,2-10H2,1H3,(H,19,21)/t13-,15-/m0/s1 |
| InChIKey | UEGGPDXADDXWAW-ZFWWWQNUSA-N |
| XLogP | 1.59 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |