C20H26N4O2 — CID 110127780
N-[(1R,2R,3R)-2-hydroxy-3-imidazol-1-ylcyclohexyl]-4-pyrrolidin-1-ylbenzamide (PubChem CID 110127780) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2-hydroxy-3-imidazol-1-ylcyclohexyl]-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[(1R,2R,3R)-2-hydroxy-3-imidazol-1-ylcyclohexyl]-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 110127780 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | N-[(1R,2R,3R)-2-hydroxy-3-imidazol-1-ylcyclohexyl]-4-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(N[C@@H]1CCCC(n2ccnc2)[C@@H]1O)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C20H26N4O2/c25-19-17(4-3-5-18(19)24-13-10-21-14-24)22-20(26)15-6-8-16(9-7-15)23-11-1-2-12-23/h6-10,13-14,17-19,25H,1-5,11-12H2,(H,22,26)/t17-,18?,19-/m1/s1 |
| InChIKey | PJEGPIPUELFNQQ-ZYYFHIKCSA-N |
| XLogP | 2.37 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |