C20H27N3O3 — CID 110127838
N-[(1R,2R,3R)-2-hydroxy-3-(2-methylimidazol-1-yl)cyclohexyl]-2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide (PubChem CID 110127838) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2-hydroxy-3-(2-methylimidazol-1-yl)cyclohexyl]-2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide.
| Compound Name | N-[(1R,2R,3R)-2-hydroxy-3-(2-methylimidazol-1-yl)cyclohexyl]-2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 110127838 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-[(1R,2R,3R)-2-hydroxy-3-(2-methylimidazol-1-yl)cyclohexyl]-2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide |
| SMILES | Cc1oc2c(c1C(=O)N[C@@H]1CCC[C@@H](n3ccnc3C)[C@@H]1O)CCCC2 |
| InChI | InChI=1S/C20H27N3O3/c1-12-18(14-6-3-4-9-17(14)26-12)20(25)22-15-7-5-8-16(19(15)24)23-11-10-21-13(23)2/h10-11,15-16,19,24H,3-9H2,1-2H3,(H,22,25)/t15-,16-,19-/m1/s1 |
| InChIKey | HCETWXLHQPASEN-GPMSIDNRSA-N |
| XLogP | 2.86 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |