C14H26N2O4 — CID 110128085
2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-morpholin-4-ylcyclohexyl]acetamide (PubChem CID 110128085) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-morpholin-4-ylcyclohexyl]acetamide.
| Compound Name | 2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-morpholin-4-ylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 110128085 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 2-ethoxy-N-[(1R,2R,3R)-2-hydroxy-3-morpholin-4-ylcyclohexyl]acetamide |
| SMILES | CCOCC(=O)N[C@@H]1CCC[C@@H](N2CCOCC2)[C@@H]1O |
| InChI | InChI=1S/C14H26N2O4/c1-2-19-10-13(17)15-11-4-3-5-12(14(11)18)16-6-8-20-9-7-16/h11-12,14,18H,2-10H2,1H3,(H,15,17)/t11-,12-,14-/m1/s1 |
| InChIKey | BMMYGOKWNLEOMS-YRGRVCCFSA-N |
| XLogP | -0.25 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |