About (4S,5S)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-5-morpholin-4-ylazepan-4-ol
(4S,5S)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-5-morpholin-4-ylazepan-4-ol (PubChem CID 110128449) has the molecular formula C15H26N4O4S
and a molecular weight of 358.46 g/mol. Its IUPAC name is (4S,5S)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-5-morpholin-4-ylazepan-4-ol.
Molecular Properties
| Compound Name | (4S,5S)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-5-morpholin-4-ylazepan-4-ol |
| PubChem CID | 110128449 |
| Molecular Formula | C15H26N4O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | (4S,5S)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-5-morpholin-4-ylazepan-4-ol |
| SMILES | Cc1nn(C)cc1S(=O)(=O)N1CC[C@H](O)[C@@H](N2CCOCC2)CC1 |
| InChI | InChI=1S/C15H26N4O4S/c1-12-15(11-17(2)16-12)24(21,22)19-5-3-13(14(20)4-6-19)18-7-9-23-10-8-18/h11,13-14,20H,3-10H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | JVCWWEAGHLJLCE-KBPBESRZSA-N |
| XLogP | -0.43 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (4S,5S)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-5-morpholin-4-ylazepan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-5-morpholin-4-ylazepan-4-ol?
The IUPAC name of (4S,5S)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-5-morpholin-4-ylazepan-4-ol (CID 110128449) is (4S,5S)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-5-morpholin-4-ylazepan-4-ol.
What is the SMILES notation for (4S,5S)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-5-morpholin-4-ylazepan-4-ol?
The canonical SMILES for (4S,5S)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-5-morpholin-4-ylazepan-4-ol is Cc1nn(C)cc1S(=O)(=O)N1CC[C@H](O)[C@@H](N2CCOCC2)CC1.
What is the InChIKey of (4S,5S)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-5-morpholin-4-ylazepan-4-ol?
The InChIKey is JVCWWEAGHLJLCE-KBPBESRZSA-N. The full InChI is InChI=1S/C15H26N4O4S/c1-12-15(11-17(2)16-12)24(21,22)19-5-3-13(14(20)4-6-19)18-7-9-23-10-8-18/h11,13-14,20H,3-10H2,1-2H3/t13-,14-/m0/s1.
What are the key properties of (4S,5S)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-5-morpholin-4-ylazepan-4-ol?
(4S,5S)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-5-morpholin-4-ylazepan-4-ol has a molecular weight of 358.46 g/mol, XLogP of -0.43, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-5-morpholin-4-ylazepan-4-ol is sourced from PubChem (CID 110128449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).