C18H33NO4 — CID 11012860
[(2,2,5,8,8-pentamethyl-3,7-dioxononan-5-yl)amino] 2-methylpropanoate (PubChem CID 11012860) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is [(2,2,5,8,8-pentamethyl-3,7-dioxononan-5-yl)amino] 2-methylpropanoate.
| Compound Name | [(2,2,5,8,8-pentamethyl-3,7-dioxononan-5-yl)amino] 2-methylpropanoate |
|---|---|
| PubChem CID | 11012860 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | [(2,2,5,8,8-pentamethyl-3,7-dioxononan-5-yl)amino] 2-methylpropanoate |
| SMILES | CC(C)C(=O)ONC(C)(CC(=O)C(C)(C)C)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H33NO4/c1-12(2)15(22)23-19-18(9,10-13(20)16(3,4)5)11-14(21)17(6,7)8/h12,19H,10-11H2,1-9H3 |
| InChIKey | WCOHUPZETFEODN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|