C15H20O8 — CID 11012872
bis[(2S)-1-methoxy-1-oxopropan-2-yl] 3,3-dimethylcyclopropene-1,2-dicarboxylate (PubChem CID 11012872) has the molecular formula C15H20O8 and a molecular weight of 328.32 g/mol. Its IUPAC name is bis[(2S)-1-methoxy-1-oxopropan-2-yl] 3,3-dimethylcyclopropene-1,2-dicarboxylate.
| Compound Name | bis[(2S)-1-methoxy-1-oxopropan-2-yl] 3,3-dimethylcyclopropene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11012872 |
| Molecular Formula | C15H20O8 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | bis[(2S)-1-methoxy-1-oxopropan-2-yl] 3,3-dimethylcyclopropene-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H](C)OC(=O)C1=C(C(=O)O[C@@H](C)C(=O)OC)C1(C)C |
| InChI | InChI=1S/C15H20O8/c1-7(11(16)20-5)22-13(18)9-10(15(9,3)4)14(19)23-8(2)12(17)21-6/h7-8H,1-6H3/t7-,8-/m0/s1 |
| InChIKey | JIHCBMAQTXBJAF-YUMQZZPRSA-N |
| XLogP | 0.53 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|