C23H26ClN5O4 — CID 110128765
4-[2-[3-[5-(4-chlorophenyl)-2-(dimethylamino)pyrimidin-4-yl]piperidin-1-yl]-2-oxoethyl]morpholine-3,5-dione (PubChem CID 110128765) has the molecular formula C23H26ClN5O4 and a molecular weight of 471.95 g/mol. Its IUPAC name is 4-[2-[3-[5-(4-chlorophenyl)-2-(dimethylamino)pyrimidin-4-yl]piperidin-1-yl]-2-oxoethyl]morpholine-3,5-dione.
| Compound Name | 4-[2-[3-[5-(4-chlorophenyl)-2-(dimethylamino)pyrimidin-4-yl]piperidin-1-yl]-2-oxoethyl]morpholine-3,5-dione |
|---|---|
| PubChem CID | 110128765 |
| Molecular Formula | C23H26ClN5O4 |
| Molecular Weight | 471.95 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 4-[2-[3-[5-(4-chlorophenyl)-2-(dimethylamino)pyrimidin-4-yl]piperidin-1-yl]-2-oxoethyl]morpholine-3,5-dione |
| SMILES | CN(C)c1ncc(-c2ccc(Cl)cc2)c(C2CCCN(C(=O)CN3C(=O)COCC3=O)C2)n1 |
| InChI | InChI=1S/C23H26ClN5O4/c1-27(2)23-25-10-18(15-5-7-17(24)8-6-15)22(26-23)16-4-3-9-28(11-16)19(30)12-29-20(31)13-33-14-21(29)32/h5-8,10,16H,3-4,9,11-14H2,1-2H3 |
| InChIKey | BHKYNUKFFFNXIA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 95.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.95 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|