C21H23FN2O3S — CID 110129768
(4R,5S)-2-[(3-fluorophenyl)methylsulfonyl]-4-phenyl-2,6-diazaspiro[4.5]decan-7-one (PubChem CID 110129768) has the molecular formula C21H23FN2O3S and a molecular weight of 402.49 g/mol. Its IUPAC name is (4R,5S)-2-[(3-fluorophenyl)methylsulfonyl]-4-phenyl-2,6-diazaspiro[4.5]decan-7-one.
| Compound Name | (4R,5S)-2-[(3-fluorophenyl)methylsulfonyl]-4-phenyl-2,6-diazaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 110129768 |
| Molecular Formula | C21H23FN2O3S |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | (4R,5S)-2-[(3-fluorophenyl)methylsulfonyl]-4-phenyl-2,6-diazaspiro[4.5]decan-7-one |
| SMILES | O=C1CCC[C@]2(CN(S(=O)(=O)Cc3cccc(F)c3)C[C@H]2c2ccccc2)N1 |
| InChI | InChI=1S/C21H23FN2O3S/c22-18-9-4-6-16(12-18)14-28(26,27)24-13-19(17-7-2-1-3-8-17)21(15-24)11-5-10-20(25)23-21/h1-4,6-9,12,19H,5,10-11,13-15H2,(H,23,25)/t19-,21+/m0/s1 |
| InChIKey | AQZNOYAWTFSHQU-PZJWPPBQSA-N |
| XLogP | 2.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |