About N-[3-[(2R,4S)-4-acetamidooxan-2-yl]phenyl]-2-(benzotriazol-1-yl)acetamide
N-[3-[(2R,4S)-4-acetamidooxan-2-yl]phenyl]-2-(benzotriazol-1-yl)acetamide (PubChem CID 110129816) has the molecular formula C21H23N5O3
and a molecular weight of 393.45 g/mol. Its IUPAC name is N-[3-[(2R,4S)-4-acetamidooxan-2-yl]phenyl]-2-(benzotriazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-[3-[(2R,4S)-4-acetamidooxan-2-yl]phenyl]-2-(benzotriazol-1-yl)acetamide |
| PubChem CID | 110129816 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-[3-[(2R,4S)-4-acetamidooxan-2-yl]phenyl]-2-(benzotriazol-1-yl)acetamide |
| SMILES | CC(=O)N[C@H]1CCO[C@@H](c2cccc(NC(=O)Cn3nnc4ccccc43)c2)C1 |
| InChI | InChI=1S/C21H23N5O3/c1-14(27)22-17-9-10-29-20(12-17)15-5-4-6-16(11-15)23-21(28)13-26-19-8-3-2-7-18(19)24-25-26/h2-8,11,17,20H,9-10,12-13H2,1H3,(H,22,27)(H,23,28)/t17-,20+/m0/s1 |
| InChIKey | HQUBEKPOQTYZEU-FXAWDEMLSA-N |
| XLogP | 2.43 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-[(2R,4S)-4-acetamidooxan-2-yl]phenyl]-2-(benzotriazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(2R,4S)-4-acetamidooxan-2-yl]phenyl]-2-(benzotriazol-1-yl)acetamide?
The IUPAC name of N-[3-[(2R,4S)-4-acetamidooxan-2-yl]phenyl]-2-(benzotriazol-1-yl)acetamide (CID 110129816) is N-[3-[(2R,4S)-4-acetamidooxan-2-yl]phenyl]-2-(benzotriazol-1-yl)acetamide.
What is the SMILES notation for N-[3-[(2R,4S)-4-acetamidooxan-2-yl]phenyl]-2-(benzotriazol-1-yl)acetamide?
The canonical SMILES for N-[3-[(2R,4S)-4-acetamidooxan-2-yl]phenyl]-2-(benzotriazol-1-yl)acetamide is CC(=O)N[C@H]1CCO[C@@H](c2cccc(NC(=O)Cn3nnc4ccccc43)c2)C1.
What is the InChIKey of N-[3-[(2R,4S)-4-acetamidooxan-2-yl]phenyl]-2-(benzotriazol-1-yl)acetamide?
The InChIKey is HQUBEKPOQTYZEU-FXAWDEMLSA-N. The full InChI is InChI=1S/C21H23N5O3/c1-14(27)22-17-9-10-29-20(12-17)15-5-4-6-16(11-15)23-21(28)13-26-19-8-3-2-7-18(19)24-25-26/h2-8,11,17,20H,9-10,12-13H2,1H3,(H,22,27)(H,23,28)/t17-,20+/m0/s1.
What are the key properties of N-[3-[(2R,4S)-4-acetamidooxan-2-yl]phenyl]-2-(benzotriazol-1-yl)acetamide?
N-[3-[(2R,4S)-4-acetamidooxan-2-yl]phenyl]-2-(benzotriazol-1-yl)acetamide has a molecular weight of 393.45 g/mol, XLogP of 2.43, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(2R,4S)-4-acetamidooxan-2-yl]phenyl]-2-(benzotriazol-1-yl)acetamide is sourced from PubChem (CID 110129816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).