About N-[2-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-1-methylpyrazole-4-carboxamide
N-[2-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-1-methylpyrazole-4-carboxamide (PubChem CID 110129919) has the molecular formula C18H22N4O3
and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[2-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-1-methylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[2-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-1-methylpyrazole-4-carboxamide |
| PubChem CID | 110129919 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-[2-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-1-methylpyrazole-4-carboxamide |
| SMILES | CC(=O)N[C@@H]1CCO[C@H](c2ccccc2NC(=O)c2cnn(C)c2)C1 |
| InChI | InChI=1S/C18H22N4O3/c1-12(23)20-14-7-8-25-17(9-14)15-5-3-4-6-16(15)21-18(24)13-10-19-22(2)11-13/h3-6,10-11,14,17H,7-9H2,1-2H3,(H,20,23)(H,21,24)/t14-,17+/m1/s1 |
| InChIKey | VFTVGPIYTKHQIT-PBHICJAKSA-N |
| XLogP | 2.03 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-1-methylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-1-methylpyrazole-4-carboxamide?
The IUPAC name of N-[2-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-1-methylpyrazole-4-carboxamide (CID 110129919) is N-[2-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-1-methylpyrazole-4-carboxamide.
What is the SMILES notation for N-[2-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-1-methylpyrazole-4-carboxamide?
The canonical SMILES for N-[2-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-1-methylpyrazole-4-carboxamide is CC(=O)N[C@@H]1CCO[C@H](c2ccccc2NC(=O)c2cnn(C)c2)C1.
What is the InChIKey of N-[2-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-1-methylpyrazole-4-carboxamide?
The InChIKey is VFTVGPIYTKHQIT-PBHICJAKSA-N. The full InChI is InChI=1S/C18H22N4O3/c1-12(23)20-14-7-8-25-17(9-14)15-5-3-4-6-16(15)21-18(24)13-10-19-22(2)11-13/h3-6,10-11,14,17H,7-9H2,1-2H3,(H,20,23)(H,21,24)/t14-,17+/m1/s1.
What are the key properties of N-[2-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-1-methylpyrazole-4-carboxamide?
N-[2-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-1-methylpyrazole-4-carboxamide has a molecular weight of 342.40 g/mol, XLogP of 2.03, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2S,4R)-4-acetamidooxan-2-yl]phenyl]-1-methylpyrazole-4-carboxamide is sourced from PubChem (CID 110129919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).